-
-
- Physical properties Key Physical Properties Value Condition Molecular Weight 339.39 - Boiling Point (Predicted) 549.8±40.0 °C Press: 760 Torr Density (Predicted) 1.318±0.06 g/cm3 Temp: 20 °C; Press: 760 Torr pKa (Predicted) 14.53±0.40 Most Acidic Temp: 25 °C Other Names and Identifiers Canonical SMILES O=C(OCC1C=2C=CC=CC2C=3C=CC=CC31)N4CC(O)CC4CO Isomeric SMILES C (OC (= o) n1 [c @ hr] (CC = CC = CC = CC4-11-11-11- (13) 20 ...
-
C13h13No5 1H-Pyrano [3,4-F] Indroizine-3,10 (4-Ethyl-4,8, Aci) - (4s) H319, H302
A 'dol suas corporra prìomh thogalaichean corporra Brùth: 760 Torr PKA (ro-innse) 11.20 ± 0.20 Temp searbhagach: 25 ° C (O) CCN13) CCN13) CCN13) C (c) [c @] 1 (O) c2 = c (= o) coc3) coc3 = o Inchi Inchi = 1S / c13h13No5 / c ... -
L-Onthinamide, L-vibral-N5- (Amelinosprbnown) - [4- (Hydroxymerthyl) H335, H315, H302, H302
A 'togail corporra prìomh thogalaichean corporra le cuideam colecular cuideam Malecular 279.45 - Ciomadh Pretion (760 ± 0043 ± 0043 ± 004 ± 0. ° C; Brùth: 760 Torr PKA (ro-innse) 13.75 ± 0.46 A 'mhòr-chuid de na h-ainmean searbhagach: 25 ° C (N) C (= O) nc1 = cc = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c = c =) [C @@] (NC ([C @ (C (CC = O) = 30-1) = o) = cc = c.1h29n5o4 / c1-11 (2) 17 (26) 23 ... -
C33H39N5O6 l-ornithinamide, n - [(9- ylinocarkyl) -n- [4- (9ci, ACI)
A 'togail corporra prìomh thogalaichean corporra air a bheil làn thogalaichean le cuideam Malecular Cuid 801.69 - Pretion Polation (ro-innse) 1.276 ± 0276 ± 0.06 Temp: 20 ° C; Brùth: 760 Torr PKA (ro-innse) 10.63 ± 0.46 A 'mhòr-chuid de Temp searbhagach: 25 ° CC = CC = CC = CC = CC = CC = CC = CC = CC = CC = CC = C.) N.) N) C (c) Tha Isomeric a 'smiler c (OC (N [c @ (n [c (N) = o) = o) c2c = 3c (... -
C21H23N3O5 l-ornithine, N5- (Ambocarbynyl) -n2 - [(9mh-fluoren-9-ylmeremoxy)
A 'togail corporra prìomh thogalaichean corporra a tha a' cur luachmhor cuideam air a bheil làn thoiseach air cuideam Malecular Cuid 397.43 - Pretion Pretions (ro-innse) 1.316 ± 0.06 temp: 20 ° C; Brùth: 760 Torr pka (ro-innse) 3.84 ± 0.21 as motha de na h-ainmean searbhagach: 25 ° CC = CC = CC = CC = CC = CC = CC = CC = CC = CC = CC = CC = CC = cc2C (= o) nc C (OC (n [c @@] (CCCNC (N) = CC = O) = CC = O) = CC = O) = CC = O) = cc219N3O5 / cc2-20 (27-5-1 ... -
C14h29No.Canents: 2 co-phàirteach RN: 474645-2-2-3--sgoinneil-3- Luchd-aonaidh (1: 1), (4s) - (ACI) - (ACI)
A 'togail corporra prìomh thogalaichean corporra [C @@] ([c @@] (cc (cc (c) (cc) (cc) (cc) c.cl Inchi Inchi = 1s / c14h29No3.clh / c1-8-10 (2-7H3; 1-7H3 - 4 +; 13 (13 -;; / tiùn Jrxgciiocitalimz-lwegjdadada-n 2 ainm eile airson an searbhag hitspoic seo -
C20H31No5 searbhag hottanoic, 3- hydroxy-5 - 4-methyl-4 - [(pheNylmathy Ester, [3mh *, 4s *)] - (9c) h301
A 'togail corporra prìomh thogalaichean corporra air a bheil làn thogalaichean air a bheil làn thogalaichean Malecular cuideam Maleud 365.46 - CARRTAS: 760 TEP: 20 ° C; Brùth: 760 Torr PKA (ro-innse) 11.82 ± 0.46 A 'mhòr-chuid de na h-ainmean searbhagach: 25 ° CC = CC = CC = CC = CC = CC = CC = CC = CC (c) cc (c) gàire cc (c) [C @ B] ([c @@] (CC (OC (cC = CC = CC = CC = CC = CC = CC = CC = CC = CC = CC = CC = CC = CC = CC = CC = CC = CC = CC (3 (22 (22) 12-1 ... -
- Physical properties Key Physical Properties Value Condition Molecular Weight 546.57 - Melting Point (Experimental) 111-112 °C Solvent: Ethyl acetate Density (Predicted) 1.343±0.06 g/cm3 Temp: 20 °C; Press: 760 Torr pKa (Predicted) 9.39±0.10 Most Acidic Temp: 25 °C Other Names and Identifiers Canonical SMILES O=C1C=CN(C(=O)N1)C2OC(COC(C=3C=CC=CC3)(C4=CC=C(OC)C=C4)C5=CC=C(OC)C=C5)C(O)C2O Tha Isomeric a 'smileneachadh C (OC [C @B [C @20) (CC = C (OC) C = c3) (c4 = c ...
-